C23H33N3O6S — CID 162120428
2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate;ethyl 2-cyanoacetate (PubChem CID 162120428) has the molecular formula C23H33N3O6S and a molecular weight of 479.60 g/mol. Its IUPAC name is 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate;ethyl 2-cyanoacetate.
| Compound Name | 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate;ethyl 2-cyanoacetate |
|---|---|
| PubChem CID | 162120428 |
| Molecular Formula | C23H33N3O6S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate;ethyl 2-cyanoacetate |
| SMILES | CCOC(=O)CC#N.CCOC(=O)c1c(N)sc2c1C1CN(C(=O)OC(C)(C)C)CC1CC2 |
| InChI | InChI=1S/C18H26N2O4S.C5H7NO2/c1-5-23-16(21)14-13-11-9-20(17(22)24-18(2,3)4)8-10(11)6-7-12(13)25-15(14)19;1-2-8-5(7)3-4-6/h10-11H,5-9,19H2,1-4H3;2-3H2,1H3 |
| InChIKey | ZHIJXAWZYQYJBT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|