C21H27ClN2O3S — CID 162120611
N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 162120611) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 162120611 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C(=O)N2C[C@H](Cl)[C@H]3CCC(=O)[C@H]32)C2CCCCC2)s1 |
| InChI | InChI=1S/C21H27ClN2O3S/c1-12-7-10-17(28-12)20(26)23-18(13-5-3-2-4-6-13)21(27)24-11-15(22)14-8-9-16(25)19(14)24/h7,10,13-15,18-19H,2-6,8-9,11H2,1H3,(H,23,26)/t14-,15+,18+,19+/m1/s1 |
| InChIKey | CTUFLCBSUIKYIM-PDWMJMLSSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|