About methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid
methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid (PubChem CID 162121636) has the molecular formula C18H15F3N2O4
and a molecular weight of 380.32 g/mol. Its IUPAC name is methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid.
Molecular Properties
| Compound Name | methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid |
| PubChem CID | 162121636 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid |
| SMILES | COc1ccc2oc(-c3ccc(C(F)(F)F)cc3)c(C(=O)O)c2c1.[H]/N=C/N |
| InChI | InChI=1S/C17H11F3O4.CH4N2/c1-23-11-6-7-13-12(8-11)14(16(21)22)15(24-13)9-2-4-10(5-3-9)17(18,19)20;2-1-3/h2-8H,1H3,(H,21,22);1H,(H3,2,3) |
| InChIKey | ZHMHFWLAHKHGKC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid?
The IUPAC name of methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid (CID 162121636) is methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid.
What is the SMILES notation for methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid?
The canonical SMILES for methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid is COc1ccc2oc(-c3ccc(C(F)(F)F)cc3)c(C(=O)O)c2c1.[H]/N=C/N.
What is the InChIKey of methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid?
The InChIKey is ZHMHFWLAHKHGKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3O4.CH4N2/c1-23-11-6-7-13-12(8-11)14(16(21)22)15(24-13)9-2-4-10(5-3-9)17(18,19)20;2-1-3/h2-8H,1H3,(H,21,22);1H,(H3,2,3).
What are the key properties of methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid?
methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid has a molecular weight of 380.32 g/mol, XLogP of 4.38, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanimidamide;5-methoxy-2-[4-(trifluoromethyl)phenyl]-1-benzofuran-3-carboxylic acid is sourced from PubChem (CID 162121636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).