C12H24O11S — CID 162122317
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal (PubChem CID 162122317) has the molecular formula C12H24O11S and a molecular weight of 376.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal |
|---|---|
| PubChem CID | 162122317 |
| Molecular Formula | C12H24O11S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2R,3R,4S,5R)-2,3,4,6-tetrahydroxy-5-sulfanylhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](S)CO |
| InChI | InChI=1S/C6H12O6.C6H12O5S/c7-1-3(9)5(11)6(12)4(10)2-8;7-1-3(9)5(10)6(11)4(12)2-8/h2*1,3-6,8-12H,2H2/t2*3-,4+,5+,6+/m00/s1 |
| InChIKey | ZHORJGDWVQWZGF-UUBOPVPUSA-N |
| XLogP | -5.82 |
| TPSA | 216.21 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|