About ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium
ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium (PubChem CID 162123103) has the molecular formula C20H54N2+2
and a molecular weight of 322.67 g/mol. Its IUPAC name is ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium.
Molecular Properties
| Compound Name | ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium |
| PubChem CID | 162123103 |
| Molecular Formula | C20H54N2+2 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 322.43 |
| IUPAC Name | ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium |
| SMILES | CC.CC.CC.CC.CC=[N+](C(C)C)C(C)C.C[NH2+]C(C)C |
| InChI | InChI=1S/C8H18N.C4H11N.4C2H6/c1-6-9(7(2)3)8(4)5;1-4(2)5-3;4*1-2/h6-8H,1-5H3;4-5H,1-3H3;4*1-2H3/q+1;;;;;/p+1 |
| InChIKey | ZHRAYSQWOBTIPC-UHFFFAOYSA-O |
| XLogP | 5.60 |
| TPSA | 19.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium?
The IUPAC name of ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium (CID 162123103) is ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium.
What is the SMILES notation for ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium?
The canonical SMILES for ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium is CC.CC.CC.CC.CC=[N+](C(C)C)C(C)C.C[NH2+]C(C)C.
What is the InChIKey of ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium?
The InChIKey is ZHRAYSQWOBTIPC-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18N.C4H11N.4C2H6/c1-6-9(7(2)3)8(4)5;1-4(2)5-3;4*1-2/h6-8H,1-5H3;4-5H,1-3H3;4*1-2H3/q+1;;;;;/p+1.
What are the key properties of ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium?
ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium has a molecular weight of 322.67 g/mol, XLogP of 5.60, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylidene-di(propan-2-yl)azanium;methyl(propan-2-yl)azanium is sourced from PubChem (CID 162123103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).