C21H24F2N6OS — CID 162124140
(2S)-7-[2-[1-[(3,5-difluorophenyl)methyl]triazol-4-yl]ethyl]-1,2,5-trimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane (PubChem CID 162124140) has the molecular formula C21H24F2N6OS and a molecular weight of 446.53 g/mol. Its IUPAC name is (2S)-7-[2-[1-[(3,5-difluorophenyl)methyl]triazol-4-yl]ethyl]-1,2,5-trimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane.
| Compound Name | (2S)-7-[2-[1-[(3,5-difluorophenyl)methyl]triazol-4-yl]ethyl]-1,2,5-trimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane |
|---|---|
| PubChem CID | 162124140 |
| Molecular Formula | C21H24F2N6OS |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2S)-7-[2-[1-[(3,5-difluorophenyl)methyl]triazol-4-yl]ethyl]-1,2,5-trimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane |
| SMILES | Cc1nc(CCc2cn(Cc3cc(F)cc(F)c3)nn2)cc2c1NC(=O)[C@H](C)N2C.S |
| InChI | InChI=1S/C21H22F2N6O.H2S/c1-12-20-19(28(3)13(2)21(30)25-20)9-17(24-12)4-5-18-11-29(27-26-18)10-14-6-15(22)8-16(23)7-14;/h6-9,11,13H,4-5,10H2,1-3H3,(H,25,30);1H2/t13-;/m0./s1 |
| InChIKey | ZHUNHRVHVHYRGS-ZOWNYOTGSA-N |
| XLogP | 2.98 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |