C31H51N7O5 — CID 162126239
N-[(2S,5R,10R,13R)-5-(cyclohexylmethyl)-2-ethyl-10-methyl-3,6,11,14-tetraoxo-13-[3-(1H-pyrazol-4-ylamino)propyl]-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide (PubChem CID 162126239) has the molecular formula C31H51N7O5 and a molecular weight of 601.79 g/mol. Its IUPAC name is N-[(2S,5R,10R,13R)-5-(cyclohexylmethyl)-2-ethyl-10-methyl-3,6,11,14-tetraoxo-13-[3-(1H-pyrazol-4-ylamino)propyl]-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide.
| Compound Name | N-[(2S,5R,10R,13R)-5-(cyclohexylmethyl)-2-ethyl-10-methyl-3,6,11,14-tetraoxo-13-[3-(1H-pyrazol-4-ylamino)propyl]-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162126239 |
| Molecular Formula | C31H51N7O5 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.40 |
| IUPAC Name | N-[(2S,5R,10R,13R)-5-(cyclohexylmethyl)-2-ethyl-10-methyl-3,6,11,14-tetraoxo-13-[3-(1H-pyrazol-4-ylamino)propyl]-1,4,7-triazacyclotetradec-10-yl]-2-methylpropanamide |
| SMILES | CC[C@@H]1NC(=O)[C@H](CCCNc2cn[nH]c2)CC(=O)[C@](C)(NC(=O)C(C)C)CCNC(=O)[C@@H](CC2CCCCC2)NC1=O |
| InChI | InChI=1S/C31H51N7O5/c1-5-24-30(43)37-25(16-21-10-7-6-8-11-21)29(42)33-15-13-31(4,38-27(40)20(2)3)26(39)17-22(28(41)36-24)12-9-14-32-23-18-34-35-19-23/h18-22,24-25,32H,5-17H2,1-4H3,(H,33,42)(H,34,35)(H,36,41)(H,37,43)(H,38,40)/t22-,24+,25-,31-/m1/s1 |
| InChIKey | ZIBIGXUBUFBQKU-UDTOEARNSA-N |
| XLogP | 2.58 |
| TPSA | 174.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|