C70H90Cl2N4O10S2 — CID 162127048
CID 162127048 (PubChem CID 162127048) has the molecular formula C70H90Cl2N4O10S2 and a molecular weight of 1282.55 g/mol.
| Compound Name | CID 162127048 |
|---|---|
| PubChem CID | 162127048 |
| Molecular Formula | C70H90Cl2N4O10S2 |
| Molecular Weight | 1282.55 g/mol |
| Exact Mass | 1280.55 |
| IUPAC Name | — |
| SMILES | C=S1(=O)NC(=O)c2ccc3c(c2)N(C[C@@H]2CC[C@H]2[C@@]2(/C=C/C[C@H](C)[C@H]1C)CCCO2)C[C@@]1(CCCc2cc(Cl)ccc21)CO3.CO[C@@]1(CO)CCC[C@H](C)[C@@H](C)S(=O)(=O)NC(=O)c2ccc3c(c2)N(C[C@@H]2CC[C@H]21)C[C@@]1(CCCc2cc(Cl)ccc21)CO3 |
| InChI | InChI=1S/C36H45ClN2O4S.C34H45ClN2O6S/c1-24-7-4-16-36(17-6-18-43-36)31-12-9-28(31)21-39-22-35(15-5-8-26-19-29(37)11-13-30(26)35)23-42-33-14-10-27(20-32(33)39)34(40)38-44(3,41)25(24)2;1-22-6-4-15-34(20-38,42-3)29-11-8-26(29)18-37-19-33(14-5-7-24-16-27(35)10-12-28(24)33)21-43-31-13-9-25(17-30(31)37)32(39)36-44(40,41)23(22)2/h4,10-11,13-14,16,19-20,24-25,28,31H,3,5-9,12,15,17-18,21-23H2,1-2H3,(H,38,40,41);9-10,12-13,16-17,22-23,26,29,38H,4-8,11,14-15,18-21H2,1-3H3,(H,36,39)/b16-4+;/t24-,25+,28-,31+,35-,36+,44?;22-,23+,26-,29+,33-,34+/m00/s1 |
| InChIKey | ZIEBGZVLHGQZSX-CILWUSKBSA-N |
| XLogP | 12.22 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1282.55 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|