About disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane
disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane (PubChem CID 162128111) has the molecular formula H4Na2O7Si2
and a molecular weight of 218.18 g/mol. Its IUPAC name is disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane.
Molecular Properties
| Compound Name | disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane |
| PubChem CID | 162128111 |
| Molecular Formula | H4Na2O7Si2 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 217.93 |
| IUPAC Name | disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane |
| SMILES | [Na+].[Na+].[O-][Si]([O-])(O)O[Si](O)(O)O |
| InChI | InChI=1S/2Na.H4O7Si2/c;;1-8(2,3)7-9(4,5)6/h;;1-4H/q2*+1;-2 |
| InChIKey | ZIHQYOJUGRUMKO-UHFFFAOYSA-N |
| XLogP | -11.43 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | -11.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane?
The IUPAC name of disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane (CID 162128111) is disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane.
What is the SMILES notation for disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane?
The canonical SMILES for disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane is [Na+].[Na+].[O-][Si]([O-])(O)O[Si](O)(O)O.
What is the InChIKey of disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane?
The InChIKey is ZIHQYOJUGRUMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/2Na.H4O7Si2/c;;1-8(2,3)7-9(4,5)6/h;;1-4H/q2*+1;-2.
What are the key properties of disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane?
disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane has a molecular weight of 218.18 g/mol, XLogP of -11.43, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;trihydroxy-[hydroxy(dioxido)silyl]oxysilane is sourced from PubChem (CID 162128111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).