C10H9NO4 — CID 162128336
cyclohexa-2,5-diene-1,4-dione;4H-1,4-oxazin-3-one (PubChem CID 162128336) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;4H-1,4-oxazin-3-one.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;4H-1,4-oxazin-3-one |
|---|---|
| PubChem CID | 162128336 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;4H-1,4-oxazin-3-one |
| SMILES | O=C1C=CC(=O)C=C1.O=C1COC=CN1 |
| InChI | InChI=1S/C6H4O2.C4H5NO2/c7-5-1-2-6(8)4-3-5;6-4-3-7-2-1-5-4/h1-4H;1-2H,3H2,(H,5,6) |
| InChIKey | ZIIJCXBULBRUFZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|