C10H13ClN6O4 — CID 162130008
6-chloro-3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide;3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide (PubChem CID 162130008) has the molecular formula C10H13ClN6O4 and a molecular weight of 316.71 g/mol. Its IUPAC name is 6-chloro-3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide;3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide.
| Compound Name | 6-chloro-3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide;3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162130008 |
| Molecular Formula | C10H13ClN6O4 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 6-chloro-3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide;3-oxo-2,4-dihydro-1H-pyrazine-2-carboxamide |
| SMILES | NC(=O)C1NC(Cl)=CNC1=O.NC(=O)C1NC=CNC1=O |
| InChI | InChI=1S/C5H6ClN3O2.C5H7N3O2/c6-2-1-8-5(11)3(9-2)4(7)10;6-4(9)3-5(10)8-2-1-7-3/h1,3,9H,(H2,7,10)(H,8,11);1-3,7H,(H2,6,9)(H,8,10) |
| InChIKey | ZINPTPDKKZJRGH-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|