C25H31N3O7S — CID 162130422
3-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-benzylsulfanyl-4-oxopentanoic acid;1-(4-nitrophenyl)ethanone (PubChem CID 162130422) has the molecular formula C25H31N3O7S and a molecular weight of 517.60 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-benzylsulfanyl-4-oxopentanoic acid;1-(4-nitrophenyl)ethanone.
| Compound Name | 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-benzylsulfanyl-4-oxopentanoic acid;1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 162130422 |
| Molecular Formula | C25H31N3O7S |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-benzylsulfanyl-4-oxopentanoic acid;1-(4-nitrophenyl)ethanone |
| SMILES | CC(=O)c1ccc([N+](=O)[O-])cc1.CC(C)[C@H](N)C(=O)NC(CC(=O)O)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O4S.C8H7NO3/c1-11(2)16(18)17(23)19-13(8-15(21)22)14(20)10-24-9-12-6-4-3-5-7-12;1-6(10)7-2-4-8(5-3-7)9(11)12/h3-7,11,13,16H,8-10,18H2,1-2H3,(H,19,23)(H,21,22);2-5H,1H3/t13?,16-;/m0./s1 |
| InChIKey | ZIOYASPNNYMWHY-GPPWNDLUSA-N |
| XLogP | 3.23 |
| TPSA | 169.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|