C12H20N+ — CID 162132341
methane;2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium (PubChem CID 162132341) has the molecular formula C12H20N+ and a molecular weight of 178.30 g/mol. Its IUPAC name is methane;2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium.
| Compound Name | methane;2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium |
|---|---|
| PubChem CID | 162132341 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | methane;2,3,5-trimethyl-5,6-dihydro-1H-indolizin-4-ium |
| SMILES | C.CC1=C(C)[N+]2=C(C=CCC2C)C1 |
| InChI | InChI=1S/C11H16N.CH4/c1-8-7-11-6-4-5-9(2)12(11)10(8)3;/h4,6,9H,5,7H2,1-3H3;1H4/q+1; |
| InChIKey | DLWLBMUNFMSOPU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|