C50H58N6O4 — CID 162132594
6-isocyano-3-methyl-N-[(4-methyl-6-oxo-2-propylcyclohexa-1,3-dien-1-yl)methyl]-1-propan-2-ylindole-4-carboxamide (PubChem CID 162132594) has the molecular formula C50H58N6O4 and a molecular weight of 807.05 g/mol. Its IUPAC name is 6-isocyano-3-methyl-N-[(4-methyl-6-oxo-2-propylcyclohexa-1,3-dien-1-yl)methyl]-1-propan-2-ylindole-4-carboxamide.
| Compound Name | 6-isocyano-3-methyl-N-[(4-methyl-6-oxo-2-propylcyclohexa-1,3-dien-1-yl)methyl]-1-propan-2-ylindole-4-carboxamide |
|---|---|
| PubChem CID | 162132594 |
| Molecular Formula | C50H58N6O4 |
| Molecular Weight | 807.05 g/mol |
| Exact Mass | 806.45 |
| IUPAC Name | 6-isocyano-3-methyl-N-[(4-methyl-6-oxo-2-propylcyclohexa-1,3-dien-1-yl)methyl]-1-propan-2-ylindole-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(C(=O)NCC2=C(CCC)C=C(C)CC2=O)c2c(C)cn(C(C)C)c2c1.[C-]#[N+]c1cc(C(=O)NCC2=C(CCC)C=C(C)CC2=O)c2c(C)cn(C(C)C)c2c1 |
| InChI | InChI=1S/2C25H29N3O2/c2*1-7-8-18-9-16(4)10-23(29)21(18)13-27-25(30)20-11-19(26-6)12-22-24(20)17(5)14-28(22)15(2)3/h2*9,11-12,14-15H,7-8,10,13H2,1-5H3,(H,27,30) |
| InChIKey | ZIVZEVAFZDQJFA-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.05 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|