C23H27N7O3S — CID 162133079
4-[[(3R)-1-but-3-ynoylpiperidin-3-yl]amino]-5-[4-(dimethylsulfamoylamino)-2-pyridinyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 162133079) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 4-[[(3R)-1-but-3-ynoylpiperidin-3-yl]amino]-5-[4-(dimethylsulfamoylamino)-2-pyridinyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-[[(3R)-1-but-3-ynoylpiperidin-3-yl]amino]-5-[4-(dimethylsulfamoylamino)-2-pyridinyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 162133079 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-[[(3R)-1-but-3-ynoylpiperidin-3-yl]amino]-5-[4-(dimethylsulfamoylamino)-2-pyridinyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#CCC(=O)N1CCC[C@@H](Nc2c(-c3cc(NS(=O)(=O)N(C)C)ccn3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C23H27N7O3S/c1-4-6-21(31)30-12-5-7-17(15-30)27-22-18-9-11-25-23(18)26-14-19(22)20-13-16(8-10-24-20)28-34(32,33)29(2)3/h1,8-11,13-14,17H,5-7,12,15H2,2-3H3,(H,24,28)(H2,25,26,27)/t17-/m1/s1 |
| InChIKey | APYJKAYTPUAFDY-QGZVFWFLSA-N |
| XLogP | 2.27 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|