C11H12N2O6 — CID 162135365
1-(3,4-dinitrophenyl)-4-methoxybutan-1-one (PubChem CID 162135365) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-(3,4-dinitrophenyl)-4-methoxybutan-1-one.
| Compound Name | 1-(3,4-dinitrophenyl)-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 162135365 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(3,4-dinitrophenyl)-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2O6/c1-19-6-2-3-11(14)8-4-5-9(12(15)16)10(7-8)13(17)18/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | FCSGIUQOXHAIES-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|