C17H31NO4 — CID 162135786
1-[(4S)-1-tert-butyl-4-(4-methoxy-2-oxobutyl)pyrrolidin-2-yl]-4-hydroxybutan-1-one (PubChem CID 162135786) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-[(4S)-1-tert-butyl-4-(4-methoxy-2-oxobutyl)pyrrolidin-2-yl]-4-hydroxybutan-1-one.
| Compound Name | 1-[(4S)-1-tert-butyl-4-(4-methoxy-2-oxobutyl)pyrrolidin-2-yl]-4-hydroxybutan-1-one |
|---|---|
| PubChem CID | 162135786 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-[(4S)-1-tert-butyl-4-(4-methoxy-2-oxobutyl)pyrrolidin-2-yl]-4-hydroxybutan-1-one |
| SMILES | COCCC(=O)C[C@@H]1CC(C(=O)CCCO)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H31NO4/c1-17(2,3)18-12-13(10-14(20)7-9-22-4)11-15(18)16(21)6-5-8-19/h13,15,19H,5-12H2,1-4H3/t13-,15?/m1/s1 |
| InChIKey | ZJGMBMCBGMDWIS-AFYYWNPRSA-N |
| XLogP | 1.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |