About 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene
1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene (PubChem CID 162138503) has the molecular formula C13H9I2N3O7
and a molecular weight of 573.04 g/mol. Its IUPAC name is 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene.
Molecular Properties
| Compound Name | 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene |
| PubChem CID | 162138503 |
| Molecular Formula | C13H9I2N3O7 |
| Molecular Weight | 573.04 g/mol |
| Exact Mass | 572.85 |
| IUPAC Name | 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene |
| SMILES | COc1cc(I)cc([N+](=O)[O-])c1.O=[N+]([O-])c1cc(I)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6INO3.C6H3IN2O4/c1-12-7-3-5(8)2-6(4-7)9(10)11;7-4-1-5(8(10)11)3-6(2-4)9(12)13/h2-4H,1H3;1-3H |
| InChIKey | ZJPQFPJOBIQNGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 573.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene?
The IUPAC name of 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene (CID 162138503) is 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene.
What is the SMILES notation for 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene?
The canonical SMILES for 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene is COc1cc(I)cc([N+](=O)[O-])c1.O=[N+]([O-])c1cc(I)cc([N+](=O)[O-])c1.
What is the InChIKey of 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene?
The InChIKey is ZJPQFPJOBIQNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6INO3.C6H3IN2O4/c1-12-7-3-5(8)2-6(4-7)9(10)11;7-4-1-5(8(10)11)3-6(2-4)9(12)13/h2-4H,1H3;1-3H.
What are the key properties of 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene?
1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene has a molecular weight of 573.04 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3,5-dinitrobenzene;1-iodo-3-methoxy-5-nitrobenzene is sourced from PubChem (CID 162138503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).