C31H47FN6O5 — CID 162140227
N-[(3R,6S,9R,12R)-9-[3-(1-aminoethenylamino)propyl]-6-ethyl-3-(4-fluorophenyl)-12-methyl-2,5,8,11-tetraoxo-1,4,7-triazacyclohexadec-12-yl]-2-methylpropanamide (PubChem CID 162140227) has the molecular formula C31H47FN6O5 and a molecular weight of 602.75 g/mol. Its IUPAC name is N-[(3R,6S,9R,12R)-9-[3-(1-aminoethenylamino)propyl]-6-ethyl-3-(4-fluorophenyl)-12-methyl-2,5,8,11-tetraoxo-1,4,7-triazacyclohexadec-12-yl]-2-methylpropanamide.
| Compound Name | N-[(3R,6S,9R,12R)-9-[3-(1-aminoethenylamino)propyl]-6-ethyl-3-(4-fluorophenyl)-12-methyl-2,5,8,11-tetraoxo-1,4,7-triazacyclohexadec-12-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162140227 |
| Molecular Formula | C31H47FN6O5 |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | N-[(3R,6S,9R,12R)-9-[3-(1-aminoethenylamino)propyl]-6-ethyl-3-(4-fluorophenyl)-12-methyl-2,5,8,11-tetraoxo-1,4,7-triazacyclohexadec-12-yl]-2-methylpropanamide |
| SMILES | C=C(N)NCCC[C@@H]1CC(=O)[C@](C)(NC(=O)C(C)C)CCCCNC(=O)[C@@H](c2ccc(F)cc2)NC(=O)[C@H](CC)NC1=O |
| InChI | InChI=1S/C31H47FN6O5/c1-6-24-29(42)37-26(21-11-13-23(32)14-12-21)30(43)35-16-8-7-15-31(5,38-27(40)19(2)3)25(39)18-22(28(41)36-24)10-9-17-34-20(4)33/h11-14,19,22,24,26,34H,4,6-10,15-18,33H2,1-3,5H3,(H,35,43)(H,36,41)(H,37,42)(H,38,40)/t22-,24+,26-,31-/m1/s1 |
| InChIKey | ZJVGFAMNXUOPKX-UQOXCYKNSA-N |
| XLogP | 2.08 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|