About 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one
1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one (PubChem CID 162141738) has the molecular formula C20H22FNO4S
and a molecular weight of 391.46 g/mol. Its IUPAC name is 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 162141738 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one |
| SMILES | C1COCCO1.CSc1cccc(-c2cc(F)c3c(c2)NC(=O)[C@@H](C)O3)c1 |
| InChI | InChI=1S/C16H14FNO2S.C4H8O2/c1-9-16(19)18-14-8-11(7-13(17)15(14)20-9)10-4-3-5-12(6-10)21-2;1-2-6-4-3-5-1/h3-9H,1-2H3,(H,18,19);1-4H2/t9-;/m1./s1 |
| InChIKey | ZJZZWKZCWDTUDY-SBSPUUFOSA-N |
| XLogP | 3.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one (CID 162141738) is 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one is C1COCCO1.CSc1cccc(-c2cc(F)c3c(c2)NC(=O)[C@@H](C)O3)c1.
What is the InChIKey of 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one?
The InChIKey is ZJZZWKZCWDTUDY-SBSPUUFOSA-N. The full InChI is InChI=1S/C16H14FNO2S.C4H8O2/c1-9-16(19)18-14-8-11(7-13(17)15(14)20-9)10-4-3-5-12(6-10)21-2;1-2-6-4-3-5-1/h3-9H,1-2H3,(H,18,19);1-4H2/t9-;/m1./s1.
What are the key properties of 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one?
1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one has a molecular weight of 391.46 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;(2R)-8-fluoro-2-methyl-6-(3-methylsulfanylphenyl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 162141738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).