About adamantan-1-amine;propanoic acid
adamantan-1-amine;propanoic acid (PubChem CID 162142210) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is adamantan-1-amine;propanoic acid.
Molecular Properties
| Compound Name | adamantan-1-amine;propanoic acid |
| PubChem CID | 162142210 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | adamantan-1-amine;propanoic acid |
| SMILES | CCC(=O)O.NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.C3H6O2/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3(4)5/h7-9H,1-6,11H2;2H2,1H3,(H,4,5) |
| InChIKey | ZKBNSGYVZWUOSW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantan-1-amine;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-1-amine;propanoic acid?
The IUPAC name of adamantan-1-amine;propanoic acid (CID 162142210) is adamantan-1-amine;propanoic acid.
What is the SMILES notation for adamantan-1-amine;propanoic acid?
The canonical SMILES for adamantan-1-amine;propanoic acid is CCC(=O)O.NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantan-1-amine;propanoic acid?
The InChIKey is ZKBNSGYVZWUOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.C3H6O2/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3(4)5/h7-9H,1-6,11H2;2H2,1H3,(H,4,5).
What are the key properties of adamantan-1-amine;propanoic acid?
adamantan-1-amine;propanoic acid has a molecular weight of 225.33 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-1-amine;propanoic acid is sourced from PubChem (CID 162142210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).