C10H12N4O4S4 — CID 162147195
formyl acetate;5-methyl-2-sulfanylidene-1,3,4-thiadiazole-3-carbaldehyde;5-methyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 162147195) has the molecular formula C10H12N4O4S4 and a molecular weight of 380.50 g/mol. Its IUPAC name is formyl acetate;5-methyl-2-sulfanylidene-1,3,4-thiadiazole-3-carbaldehyde;5-methyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | formyl acetate;5-methyl-2-sulfanylidene-1,3,4-thiadiazole-3-carbaldehyde;5-methyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 162147195 |
| Molecular Formula | C10H12N4O4S4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | formyl acetate;5-methyl-2-sulfanylidene-1,3,4-thiadiazole-3-carbaldehyde;5-methyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CC(=O)OC=O.Cc1n[nH]c(=S)s1.Cc1nn(C=O)c(=S)s1 |
| InChI | InChI=1S/C4H4N2OS2.C3H4N2S2.C3H4O3/c1-3-5-6(2-7)4(8)9-3;1-2-4-5-3(6)7-2;1-3(5)6-2-4/h2H,1H3;1H3,(H,5,6);2H,1H3 |
| InChIKey | ZKSFXRRKEWPGKQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|