C20H19FN4O2S — CID 162147472
5-(4-fluorophenyl)sulfonyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 162147472) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 162147472 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1nc(Nc2c3c(cc4c2CCC4)CCC3)n[nH]1 |
| InChI | InChI=1S/C20H19FN4O2S/c21-14-7-9-15(10-8-14)28(26,27)20-23-19(24-25-20)22-18-16-5-1-3-12(16)11-13-4-2-6-17(13)18/h7-11H,1-6H2,(H2,22,23,24,25) |
| InChIKey | ZKTIFAXRVHBKDO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |