C20H16F3N — CID 162147514
4-methyl-N-phenyl-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 162147514) has the molecular formula C20H16F3N and a molecular weight of 327.35 g/mol. Its IUPAC name is 4-methyl-N-phenyl-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 4-methyl-N-phenyl-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 162147514 |
| Molecular Formula | C20H16F3N |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-methyl-N-phenyl-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H16F3N/c1-15-7-11-18(12-8-15)24(17-5-3-2-4-6-17)19-13-9-16(10-14-19)20(21,22)23/h2-14H,1H3 |
| InChIKey | ZKTLOCYPYLHHNS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |