About (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane
(3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane (PubChem CID 162148696) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane.
Molecular Properties
| Compound Name | (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane |
| PubChem CID | 162148696 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane |
| SMILES | CCC.COCC[C@H]1CNCC[C@@H]1C |
| InChI | InChI=1S/C9H19NO.C3H8/c1-8-3-5-10-7-9(8)4-6-11-2;1-3-2/h8-10H,3-7H2,1-2H3;3H2,1-2H3/t8-,9-;/m0./s1 |
| InChIKey | ZKXGDHRTAMUZLG-OZZZDHQUSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane?
The IUPAC name of (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane (CID 162148696) is (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane.
What is the SMILES notation for (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane?
The canonical SMILES for (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane is CCC.COCC[C@H]1CNCC[C@@H]1C.
What is the InChIKey of (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane?
The InChIKey is ZKXGDHRTAMUZLG-OZZZDHQUSA-N. The full InChI is InChI=1S/C9H19NO.C3H8/c1-8-3-5-10-7-9(8)4-6-11-2;1-3-2/h8-10H,3-7H2,1-2H3;3H2,1-2H3/t8-,9-;/m0./s1.
What are the key properties of (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane?
(3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane has a molecular weight of 201.35 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-(2-methoxyethyl)-4-methylpiperidine;propane is sourced from PubChem (CID 162148696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).