About (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole
(4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole (PubChem CID 162148943) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole |
| PubChem CID | 162148943 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole |
| SMILES | CC(C)[C@H]1N=COC1(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H31NO/c1-14(2)17-18(20-13-19-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h13-17H,3-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | PEOQVYKJQSIZFZ-QGZVFWFLSA-N |
| XLogP | 4.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole?
The IUPAC name of (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole (CID 162148943) is (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole.
What is the SMILES notation for (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole?
The canonical SMILES for (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole is CC(C)[C@H]1N=COC1(C1CCCCC1)C1CCCCC1.
What is the InChIKey of (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole?
The InChIKey is PEOQVYKJQSIZFZ-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H31NO/c1-14(2)17-18(20-13-19-17,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h13-17H,3-12H2,1-2H3/t17-/m1/s1.
What are the key properties of (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole?
(4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole has a molecular weight of 277.45 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5-dicyclohexyl-4-propan-2-yl-4H-1,3-oxazole is sourced from PubChem (CID 162148943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).