C59H42S3Se — CID 162152656
9,15-bis(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylfluoren-3-yl)-5,8,14-trithia-18-selenapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene (PubChem CID 162152656) has the molecular formula C59H42S3Se and a molecular weight of 926.15 g/mol. Its IUPAC name is 9,15-bis(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylfluoren-3-yl)-5,8,14-trithia-18-selenapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene.
| Compound Name | 9,15-bis(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylfluoren-3-yl)-5,8,14-trithia-18-selenapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 162152656 |
| Molecular Formula | C59H42S3Se |
| Molecular Weight | 926.15 g/mol |
| Exact Mass | 926.16 |
| IUPAC Name | 9,15-bis(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylfluoren-3-yl)-5,8,14-trithia-18-selenapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cc4c(s3)c3sc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc3c3c5sc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)cc5[se]c43)ccc21 |
| InChI | InChI=1S/C59H42S3Se/c1-57(2)44-18-12-9-15-36(44)39-25-31(21-24-45(39)57)49-29-41-54(61-49)53-40(28-48(60-53)32-19-22-37-34-13-7-10-16-42(34)58(3,4)46(37)26-32)52-55-51(63-56(41)52)30-50(62-55)33-20-23-38-35-14-8-11-17-43(35)59(5,6)47(38)27-33/h7-30H,1-6H3 |
| InChIKey | OPNCLAQASBMDQV-UHFFFAOYSA-N |
| XLogP | 17.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.15 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|