C18H14Cl2F2N2O2 — CID 162152967
5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-methyl-1,4,2-dioxazole (PubChem CID 162152967) has the molecular formula C18H14Cl2F2N2O2 and a molecular weight of 399.22 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-methyl-1,4,2-dioxazole.
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-methyl-1,4,2-dioxazole |
|---|---|
| PubChem CID | 162152967 |
| Molecular Formula | C18H14Cl2F2N2O2 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-methyl-1,4,2-dioxazole |
| SMILES | CC1(c2cc(Cl)c(F)c(Cl)c2)ON=C(c2ccc(C3(F)CNC3)cc2)O1 |
| InChI | InChI=1S/C18H14Cl2F2N2O2/c1-17(12-6-13(19)15(21)14(20)7-12)25-16(24-26-17)10-2-4-11(5-3-10)18(22)8-23-9-18/h2-7,23H,8-9H2,1H3 |
| InChIKey | ZUWGFSYWZUNADP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|