C20H16ClF3N4O2 — CID 162156801
5-[(3-chlorophenyl)methyl]-3-[[2-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 162156801) has the molecular formula C20H16ClF3N4O2 and a molecular weight of 436.82 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[[2-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[[2-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162156801 |
| Molecular Formula | C20H16ClF3N4O2 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[[2-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(C(F)(F)F)cc1/C=N/c1n[nH]c(Cc2cccc(Cl)c2)c1C(N)=O |
| InChI | InChI=1S/C20H16ClF3N4O2/c1-30-16-6-5-13(20(22,23)24)9-12(16)10-26-19-17(18(25)29)15(27-28-19)8-11-3-2-4-14(21)7-11/h2-7,9-10H,8H2,1H3,(H2,25,29)(H,27,28)/b26-10+ |
| InChIKey | YLQUXYVAHDCUET-NSKAYECMSA-N |
| XLogP | 4.53 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|