About 2,2-ditert-butylpropanediamide;dichlorotitanium
2,2-ditert-butylpropanediamide;dichlorotitanium (PubChem CID 162157622) has the molecular formula C11H22Cl2N2O2Ti
and a molecular weight of 333.08 g/mol. Its IUPAC name is 2,2-ditert-butylpropanediamide;dichlorotitanium.
Molecular Properties
| Compound Name | 2,2-ditert-butylpropanediamide;dichlorotitanium |
| PubChem CID | 162157622 |
| Molecular Formula | C11H22Cl2N2O2Ti |
| Molecular Weight | 333.08 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2,2-ditert-butylpropanediamide;dichlorotitanium |
| SMILES | CC(C)(C)C(C(N)=O)(C(N)=O)C(C)(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C11H22N2O2.2ClH.Ti/c1-9(2,3)11(7(12)14,8(13)15)10(4,5)6;;;/h1-6H3,(H2,12,14)(H2,13,15);2*1H;/q;;;+2/p-2 |
| InChIKey | ZMAQUKKAUCUVFJ-UHFFFAOYSA-L |
| XLogP | 2.41 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-ditert-butylpropanediamide;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-ditert-butylpropanediamide;dichlorotitanium?
The IUPAC name of 2,2-ditert-butylpropanediamide;dichlorotitanium (CID 162157622) is 2,2-ditert-butylpropanediamide;dichlorotitanium.
What is the SMILES notation for 2,2-ditert-butylpropanediamide;dichlorotitanium?
The canonical SMILES for 2,2-ditert-butylpropanediamide;dichlorotitanium is CC(C)(C)C(C(N)=O)(C(N)=O)C(C)(C)C.Cl[Ti]Cl.
What is the InChIKey of 2,2-ditert-butylpropanediamide;dichlorotitanium?
The InChIKey is ZMAQUKKAUCUVFJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H22N2O2.2ClH.Ti/c1-9(2,3)11(7(12)14,8(13)15)10(4,5)6;;;/h1-6H3,(H2,12,14)(H2,13,15);2*1H;/q;;;+2/p-2.
What are the key properties of 2,2-ditert-butylpropanediamide;dichlorotitanium?
2,2-ditert-butylpropanediamide;dichlorotitanium has a molecular weight of 333.08 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-ditert-butylpropanediamide;dichlorotitanium is sourced from PubChem (CID 162157622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).