3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid

C9H12O2 — CID 162158340

IUPAC3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid
SMILESCC(C)C1=CCC(C(=O)O)=C1
InChIInChI=1S/C9H12O2/c1-6(2)7-3-4-8(5-7)9(10)11/h3,5-6H,4H2,1-2H3,(H,10,11)
InChIKeyJXEVFVVEUKHYBN-UHFFFAOYSA-N
MW152.19 g/mol
LogP1.98
Rot. Bonds2

About 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid

3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid (PubChem CID 162158340) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid.

Molecular Properties

Compound Name3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid
PubChem CID162158340
Molecular FormulaC9H12O2
Molecular Weight152.19 g/mol
Exact Mass152.08
IUPAC Name3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid
SMILESCC(C)C1=CCC(C(=O)O)=C1
InChIInChI=1S/C9H12O2/c1-6(2)7-3-4-8(5-7)9(10)11/h3,5-6H,4H2,1-2H3,(H,10,11)
InChIKeyJXEVFVVEUKHYBN-UHFFFAOYSA-N
XLogP1.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.19
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid?
The IUPAC name of 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid (CID 162158340) is 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid?
The canonical SMILES for 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid is CC(C)C1=CCC(C(=O)O)=C1.
What is the InChIKey of 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid?
The InChIKey is JXEVFVVEUKHYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-6(2)7-3-4-8(5-7)9(10)11/h3,5-6H,4H2,1-2H3,(H,10,11).
What are the key properties of 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid?
3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid has a molecular weight of 152.19 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylcyclopenta-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 162158340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).