C41H37N9O7 — CID 162158918
3-methyl-7-(2-nitroethoxy)-5H-pyrido[3,2-b]indole;7-(2-nitroethyl)-5H-pyrido[4,3-b]indole;7-(3-nitropropyl)-5H-pyrido[4,3-b]indole (PubChem CID 162158918) has the molecular formula C41H37N9O7 and a molecular weight of 767.80 g/mol. Its IUPAC name is 3-methyl-7-(2-nitroethoxy)-5H-pyrido[3,2-b]indole;7-(2-nitroethyl)-5H-pyrido[4,3-b]indole;7-(3-nitropropyl)-5H-pyrido[4,3-b]indole.
| Compound Name | 3-methyl-7-(2-nitroethoxy)-5H-pyrido[3,2-b]indole;7-(2-nitroethyl)-5H-pyrido[4,3-b]indole;7-(3-nitropropyl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 162158918 |
| Molecular Formula | C41H37N9O7 |
| Molecular Weight | 767.80 g/mol |
| Exact Mass | 767.28 |
| IUPAC Name | 3-methyl-7-(2-nitroethoxy)-5H-pyrido[3,2-b]indole;7-(2-nitroethyl)-5H-pyrido[4,3-b]indole;7-(3-nitropropyl)-5H-pyrido[4,3-b]indole |
| SMILES | Cc1cnc2c(c1)[nH]c1cc(OCC[N+](=O)[O-])ccc12.O=[N+]([O-])CCCc1ccc2c(c1)[nH]c1ccncc12.O=[N+]([O-])CCc1ccc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C14H13N3O3.C14H13N3O2.C13H11N3O2/c1-9-6-13-14(15-8-9)11-3-2-10(7-12(11)16-13)20-5-4-17(18)19;18-17(19)7-1-2-10-3-4-11-12-9-15-6-5-13(12)16-14(11)8-10;17-16(18)6-4-9-1-2-10-11-8-14-5-3-12(11)15-13(10)7-9/h2-3,6-8,16H,4-5H2,1H3;3-6,8-9,16H,1-2,7H2;1-3,5,7-8,15H,4,6H2 |
| InChIKey | ZMEYJFQWVNZNAR-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 224.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.80 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|