C25H34O2 — CID 162159087
methane;1-methyl-2-[(2-methylphenoxy)methoxy]benzene;1,4-xylene (PubChem CID 162159087) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is methane;1-methyl-2-[(2-methylphenoxy)methoxy]benzene;1,4-xylene.
| Compound Name | methane;1-methyl-2-[(2-methylphenoxy)methoxy]benzene;1,4-xylene |
|---|---|
| PubChem CID | 162159087 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | methane;1-methyl-2-[(2-methylphenoxy)methoxy]benzene;1,4-xylene |
| SMILES | C.C.Cc1ccc(C)cc1.Cc1ccccc1OCOc1ccccc1C |
| InChI | InChI=1S/C15H16O2.C8H10.2CH4/c1-12-7-3-5-9-14(12)16-11-17-15-10-6-4-8-13(15)2;1-7-3-5-8(2)6-4-7;;/h3-10H,11H2,1-2H3;3-6H,1-2H3;2*1H4 |
| InChIKey | ZMFOXFGBALIKAR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|