About 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane
5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane (PubChem CID 162161979) has the molecular formula C17H25BrN2O2Sn
and a molecular weight of 488.01 g/mol. Its IUPAC name is 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane.
Molecular Properties
| Compound Name | 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane |
| PubChem CID | 162161979 |
| Molecular Formula | C17H25BrN2O2Sn |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane |
| SMILES | CCOc1ccc(Br)cn1.CCOc1ccc([Sn](C)(C)C)cn1 |
| InChI | InChI=1S/C7H8BrNO.C7H8NO.3CH3.Sn/c1-2-10-7-4-3-6(8)5-9-7;1-2-9-7-5-3-4-6-8-7;;;;/h3-5H,2H2,1H3;3,5-6H,2H2,1H3;3*1H3; |
| InChIKey | ZMPMCMRHSGZELN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane?
The IUPAC name of 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane (CID 162161979) is 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane.
What is the SMILES notation for 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane?
The canonical SMILES for 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane is CCOc1ccc(Br)cn1.CCOc1ccc([Sn](C)(C)C)cn1.
What is the InChIKey of 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane?
The InChIKey is ZMPMCMRHSGZELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO.C7H8NO.3CH3.Sn/c1-2-10-7-4-3-6(8)5-9-7;1-2-9-7-5-3-4-6-8-7;;;;/h3-5H,2H2,1H3;3,5-6H,2H2,1H3;3*1H3;.
What are the key properties of 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane?
5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane has a molecular weight of 488.01 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-ethoxypyridine;(6-ethoxy-3-pyridinyl)-trimethylstannane is sourced from PubChem (CID 162161979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).