C19H28N2O4Y — CID 162162945
methane;2-methyl-9-(4-methylcyclohexyl)-2,9-diazadispiro[3.2.37.24]dodecane-1,3,8,10-tetrone;yttrium (PubChem CID 162162945) has the molecular formula C19H28N2O4Y and a molecular weight of 437.35 g/mol. Its IUPAC name is methane;2-methyl-9-(4-methylcyclohexyl)-2,9-diazadispiro[3.2.37.24]dodecane-1,3,8,10-tetrone;yttrium.
| Compound Name | methane;2-methyl-9-(4-methylcyclohexyl)-2,9-diazadispiro[3.2.37.24]dodecane-1,3,8,10-tetrone;yttrium |
|---|---|
| PubChem CID | 162162945 |
| Molecular Formula | C19H28N2O4Y |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | methane;2-methyl-9-(4-methylcyclohexyl)-2,9-diazadispiro[3.2.37.24]dodecane-1,3,8,10-tetrone;yttrium |
| SMILES | C.CC1CCC(N2C(=O)C3(CCC4(CC3)C(=O)N(C)C4=O)C2=O)CC1.[Y] |
| InChI | InChI=1S/C18H24N2O4.CH4.Y/c1-11-3-5-12(6-4-11)20-15(23)18(16(20)24)9-7-17(8-10-18)13(21)19(2)14(17)22;;/h11-12H,3-10H2,1-2H3;1H4; |
| InChIKey | ZMSSEYFTCBXTDI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|