C38H40N6+2 — CID 162163309
1-(2,6-dimethylphenyl)-2,3-dimethylimidazo[4,5-b]indolizin-1-ium;3-(2,6-dimethylphenyl)-1,2-dimethylimidazo[4,5-b]indolizin-1-ium (PubChem CID 162163309) has the molecular formula C38H40N6+2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2,3-dimethylimidazo[4,5-b]indolizin-1-ium;3-(2,6-dimethylphenyl)-1,2-dimethylimidazo[4,5-b]indolizin-1-ium.
| Compound Name | 1-(2,6-dimethylphenyl)-2,3-dimethylimidazo[4,5-b]indolizin-1-ium;3-(2,6-dimethylphenyl)-1,2-dimethylimidazo[4,5-b]indolizin-1-ium |
|---|---|
| PubChem CID | 162163309 |
| Molecular Formula | C38H40N6+2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2,3-dimethylimidazo[4,5-b]indolizin-1-ium;3-(2,6-dimethylphenyl)-1,2-dimethylimidazo[4,5-b]indolizin-1-ium |
| SMILES | Cc1cccc(C)c1-[n+]1c(C)n(C)c2cc3ccccn3c21.Cc1cccc(C)c1-n1c(C)[n+](C)c2c1cc1ccccn12 |
| InChI | InChI=1S/2C19H20N3/c1-13-8-7-9-14(2)18(13)22-15(3)20(4)19-17(22)12-16-10-5-6-11-21(16)19;1-13-8-7-9-14(2)18(13)22-15(3)20(4)17-12-16-10-5-6-11-21(16)19(17)22/h2*5-12H,1-4H3/q2*+1 |
| InChIKey | HSNQTTGDKFNECE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 26.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|