C11H11NO3 — CID 162164289
3-[(3,4-dimethylphenyl)methyl]-1,4,2-dioxazol-5-one (PubChem CID 162164289) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)methyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[(3,4-dimethylphenyl)methyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 162164289 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)methyl]-1,4,2-dioxazol-5-one |
| SMILES | Cc1ccc(Cc2noc(=O)o2)cc1C |
| InChI | InChI=1S/C11H11NO3/c1-7-3-4-9(5-8(7)2)6-10-12-15-11(13)14-10/h3-5H,6H2,1-2H3 |
| InChIKey | ZMXLZEAEOYVBQD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |