C74H94 — CID 162165852
1,2,3,4,5,6-hexamethylbenzene;1,3,4,5,6,8-hexamethyl-2,7-bis(2,3,4,5,6-pentamethylphenyl)-9H-fluorene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene (PubChem CID 162165852) has the molecular formula C74H94 and a molecular weight of 983.57 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylbenzene;1,3,4,5,6,8-hexamethyl-2,7-bis(2,3,4,5,6-pentamethylphenyl)-9H-fluorene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene.
| Compound Name | 1,2,3,4,5,6-hexamethylbenzene;1,3,4,5,6,8-hexamethyl-2,7-bis(2,3,4,5,6-pentamethylphenyl)-9H-fluorene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene |
|---|---|
| PubChem CID | 162165852 |
| Molecular Formula | C74H94 |
| Molecular Weight | 983.57 g/mol |
| Exact Mass | 982.74 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylbenzene;1,3,4,5,6,8-hexamethyl-2,7-bis(2,3,4,5,6-pentamethylphenyl)-9H-fluorene;1,2,3,4,5,6,7,8-octamethyl-9H-fluorene |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c3c(c2C)Cc2c(C)c(-c4c(C)c(C)c(C)c(C)c4C)c(C)c(C)c2-3)c(C)c1C.Cc1c(C)c(C)c(C)c(C)c1C.Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C)c(C)c1-2 |
| InChI | InChI=1S/C41H50.C21H26.C12H18/c1-18-20(3)24(7)36(25(8)21(18)4)38-28(11)30(13)40-34(32(38)15)17-35-33(16)39(29(12)31(14)41(35)40)37-26(9)22(5)19(2)23(6)27(37)10;1-10-12(3)16(7)20-18(14(10)5)9-19-15(6)11(2)13(4)17(8)21(19)20;1-7-8(2)10(4)12(6)11(5)9(7)3/h17H2,1-16H3;9H2,1-8H3;1-6H3 |
| InChIKey | ZNCPHSOZVCBYKW-UHFFFAOYSA-N |
| XLogP | 20.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.57 |
| LogP ≤ 5 | 20.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |