C24H25ClN4O8 — CID 162166212
3-amino-1-benzofuran-2-carboxamide;ethyl N-(2-carbamoyl-1-benzofuran-3-yl)carbamate;ethyl carbonochloridate (PubChem CID 162166212) has the molecular formula C24H25ClN4O8 and a molecular weight of 532.94 g/mol. Its IUPAC name is 3-amino-1-benzofuran-2-carboxamide;ethyl N-(2-carbamoyl-1-benzofuran-3-yl)carbamate;ethyl carbonochloridate.
| Compound Name | 3-amino-1-benzofuran-2-carboxamide;ethyl N-(2-carbamoyl-1-benzofuran-3-yl)carbamate;ethyl carbonochloridate |
|---|---|
| PubChem CID | 162166212 |
| Molecular Formula | C24H25ClN4O8 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 3-amino-1-benzofuran-2-carboxamide;ethyl N-(2-carbamoyl-1-benzofuran-3-yl)carbamate;ethyl carbonochloridate |
| SMILES | CCOC(=O)Cl.CCOC(=O)Nc1c(C(N)=O)oc2ccccc12.NC(=O)c1oc2ccccc2c1N |
| InChI | InChI=1S/C12H12N2O4.C9H8N2O2.C3H5ClO2/c1-2-17-12(16)14-9-7-5-3-4-6-8(7)18-10(9)11(13)15;10-7-5-3-1-2-4-6(5)13-8(7)9(11)12;1-2-6-3(4)5/h3-6H,2H2,1H3,(H2,13,15)(H,14,16);1-4H,10H2,(H2,11,12);2H2,1H3 |
| InChIKey | ZNDXGESGMCPIKV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 203.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|