About trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone
trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone (PubChem CID 162166641) has the molecular formula C37H30AsCl3OPRh
and a molecular weight of 805.81 g/mol. Its IUPAC name is trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone.
Molecular Properties
| Compound Name | trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone |
| PubChem CID | 162166641 |
| Molecular Formula | C37H30AsCl3OPRh |
| Molecular Weight | 805.81 g/mol |
| Exact Mass | 803.94 |
| IUPAC Name | trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone |
| SMILES | Cl[Rh](Cl)Cl.O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([As](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15OP.C18H15As.3ClH.Rh/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;1-15H;3*1H;/q;;;;;+3/p-3 |
| InChIKey | ZNFJUMXSBYIOBX-UHFFFAOYSA-K |
| XLogP | 7.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 805.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone?
The IUPAC name of trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone (CID 162166641) is trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone.
What is the SMILES notation for trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone?
The canonical SMILES for trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone is Cl[Rh](Cl)Cl.O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([As](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone?
The InChIKey is ZNFJUMXSBYIOBX-UHFFFAOYSA-K. The full InChI is InChI=1S/C19H15OP.C18H15As.3ClH.Rh/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;1-15H;3*1H;/q;;;;;+3/p-3.
What are the key properties of trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone?
trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone has a molecular weight of 805.81 g/mol, XLogP of 7.32, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trichlororhodium;triphenylarsane;(triphenyl-λ5-phosphanylidene)methanone is sourced from PubChem (CID 162166641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).