About dimethylsilane;1-methyl-2-(2-methylphenyl)benzene
dimethylsilane;1-methyl-2-(2-methylphenyl)benzene (PubChem CID 162166796) has the molecular formula C16H22Si
and a molecular weight of 242.44 g/mol. Its IUPAC name is dimethylsilane;1-methyl-2-(2-methylphenyl)benzene.
Molecular Properties
| Compound Name | dimethylsilane;1-methyl-2-(2-methylphenyl)benzene |
| PubChem CID | 162166796 |
| Molecular Formula | C16H22Si |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | dimethylsilane;1-methyl-2-(2-methylphenyl)benzene |
| SMILES | C[SiH2]C.Cc1ccccc1-c1ccccc1C |
| InChI | InChI=1S/C14H14.C2H8Si/c1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2;1-3-2/h3-10H,1-2H3;3H2,1-2H3 |
| InChIKey | ZNFXCAXZRCQTJB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilane;1-methyl-2-(2-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilane;1-methyl-2-(2-methylphenyl)benzene?
The IUPAC name of dimethylsilane;1-methyl-2-(2-methylphenyl)benzene (CID 162166796) is dimethylsilane;1-methyl-2-(2-methylphenyl)benzene.
What is the SMILES notation for dimethylsilane;1-methyl-2-(2-methylphenyl)benzene?
The canonical SMILES for dimethylsilane;1-methyl-2-(2-methylphenyl)benzene is C[SiH2]C.Cc1ccccc1-c1ccccc1C.
What is the InChIKey of dimethylsilane;1-methyl-2-(2-methylphenyl)benzene?
The InChIKey is ZNFXCAXZRCQTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H8Si/c1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2;1-3-2/h3-10H,1-2H3;3H2,1-2H3.
What are the key properties of dimethylsilane;1-methyl-2-(2-methylphenyl)benzene?
dimethylsilane;1-methyl-2-(2-methylphenyl)benzene has a molecular weight of 242.44 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilane;1-methyl-2-(2-methylphenyl)benzene is sourced from PubChem (CID 162166796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).