C34H29IN6O8S2 — CID 162168101
4-[(2-hydroxy-4-iodo-1H-indol-3-yl)methylideneamino]benzenesulfonamide;methyl (E)-3-[2-hydroxy-3-[(4-sulfamoylphenyl)iminomethyl]-1H-indol-4-yl]prop-2-enoate (PubChem CID 162168101) has the molecular formula C34H29IN6O8S2 and a molecular weight of 840.68 g/mol. Its IUPAC name is 4-[(2-hydroxy-4-iodo-1H-indol-3-yl)methylideneamino]benzenesulfonamide;methyl (E)-3-[2-hydroxy-3-[(4-sulfamoylphenyl)iminomethyl]-1H-indol-4-yl]prop-2-enoate.
| Compound Name | 4-[(2-hydroxy-4-iodo-1H-indol-3-yl)methylideneamino]benzenesulfonamide;methyl (E)-3-[2-hydroxy-3-[(4-sulfamoylphenyl)iminomethyl]-1H-indol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162168101 |
| Molecular Formula | C34H29IN6O8S2 |
| Molecular Weight | 840.68 g/mol |
| Exact Mass | 840.05 |
| IUPAC Name | 4-[(2-hydroxy-4-iodo-1H-indol-3-yl)methylideneamino]benzenesulfonamide;methyl (E)-3-[2-hydroxy-3-[(4-sulfamoylphenyl)iminomethyl]-1H-indol-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc2[nH]c(O)c(/C=N/c3ccc(S(N)(=O)=O)cc3)c12.NS(=O)(=O)c1ccc(/N=C/c2c(O)[nH]c3cccc(I)c23)cc1 |
| InChI | InChI=1S/C19H17N3O5S.C15H12IN3O3S/c1-27-17(23)10-5-12-3-2-4-16-18(12)15(19(24)22-16)11-21-13-6-8-14(9-7-13)28(20,25)26;16-12-2-1-3-13-14(12)11(15(20)19-13)8-18-9-4-6-10(7-5-9)23(17,21)22/h2-11,22,24H,1H3,(H2,20,25,26);1-8,19-20H,(H2,17,21,22)/b10-5+,21-11+;18-8+ |
| InChIKey | CRLCDVCUBYRPLW-BMGJYKOTSA-N |
| XLogP | 5.33 |
| TPSA | 243.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|