About N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride
N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride (PubChem CID 162168720) has the molecular formula C9H9ClN2O3S
and a molecular weight of 260.70 g/mol. Its IUPAC name is N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride |
| PubChem CID | 162168720 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride |
| SMILES | Cl.NC(=NO)c1cc2cc(O)c(O)cc2s1 |
| InChI | InChI=1S/C9H8N2O3S.ClH/c10-9(11-14)8-2-4-1-5(12)6(13)3-7(4)15-8;/h1-3,12-14H,(H2,10,11);1H |
| InChIKey | NAYPNWCQPVXWNS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride?
The IUPAC name of N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride (CID 162168720) is N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride.
What is the SMILES notation for N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride?
The canonical SMILES for N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride is Cl.NC(=NO)c1cc2cc(O)c(O)cc2s1.
What is the InChIKey of N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride?
The InChIKey is NAYPNWCQPVXWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S.ClH/c10-9(11-14)8-2-4-1-5(12)6(13)3-7(4)15-8;/h1-3,12-14H,(H2,10,11);1H.
What are the key properties of N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride?
N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride has a molecular weight of 260.70 g/mol, XLogP of 1.83, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',5,6-trihydroxy-1-benzothiophene-2-carboximidamide;hydrochloride is sourced from PubChem (CID 162168720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).