C8H18O5 — CID 162168803
methane;1,3,4,5-tetrahydroxy-4-methylhexan-2-one (PubChem CID 162168803) has the molecular formula C8H18O5 and a molecular weight of 194.23 g/mol. Its IUPAC name is methane;1,3,4,5-tetrahydroxy-4-methylhexan-2-one.
| Compound Name | methane;1,3,4,5-tetrahydroxy-4-methylhexan-2-one |
|---|---|
| PubChem CID | 162168803 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | methane;1,3,4,5-tetrahydroxy-4-methylhexan-2-one |
| SMILES | C.CC(O)C(C)(O)C(O)C(=O)CO |
| InChI | InChI=1S/C7H14O5.CH4/c1-4(9)7(2,12)6(11)5(10)3-8;/h4,6,8-9,11-12H,3H2,1-2H3;1H4 |
| InChIKey | ZNMUSNQOQZWDDA-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |