C6H14Cl3NO2Si — CID 162171903
3-amino-3-(trichlorosilylmethyl)pentane-1,5-diol (PubChem CID 162171903) has the molecular formula C6H14Cl3NO2Si and a molecular weight of 266.63 g/mol. Its IUPAC name is 3-amino-3-(trichlorosilylmethyl)pentane-1,5-diol.
| Compound Name | 3-amino-3-(trichlorosilylmethyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 162171903 |
| Molecular Formula | C6H14Cl3NO2Si |
| Molecular Weight | 266.63 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 3-amino-3-(trichlorosilylmethyl)pentane-1,5-diol |
| SMILES | NC(CCO)(CCO)C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H14Cl3NO2Si/c7-13(8,9)5-6(10,1-3-11)2-4-12/h11-12H,1-5,10H2 |
| InChIKey | ZNXDVSXGABPVBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.63 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|