About 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione
3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione (PubChem CID 162174000) has the molecular formula C10H15NO8
and a molecular weight of 277.23 g/mol. Its IUPAC name is 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 162174000 |
| Molecular Formula | C10H15NO8 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CCOCCC(=O)O.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C6H10O5.C4H5NO3/c7-5(8)1-3-11-4-2-6(9)10;6-2-1-3(7)5-4(2)8/h1-4H2,(H,7,8)(H,9,10);2,6H,1H2,(H,5,7,8) |
| InChIKey | ZODNVVYXOMWEJM-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione?
The IUPAC name of 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione (CID 162174000) is 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione is O=C(O)CCOCCC(=O)O.O=C1CC(O)C(=O)N1.
What is the InChIKey of 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione?
The InChIKey is ZODNVVYXOMWEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5.C4H5NO3/c7-5(8)1-3-11-4-2-6(9)10;6-2-1-3(7)5-4(2)8/h1-4H2,(H,7,8)(H,9,10);2,6H,1H2,(H,5,7,8).
What are the key properties of 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione?
3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione has a molecular weight of 277.23 g/mol, XLogP of -1.65, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-carboxyethoxy)propanoic acid;3-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 162174000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).