C11H10N4 — CID 162174860
5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine (PubChem CID 162174860) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine.
| Compound Name | 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 162174860 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine |
| SMILES | CN1c2ncccc2Cc2nccnc21 |
| InChI | InChI=1S/C11H10N4/c1-15-10-8(3-2-4-13-10)7-9-11(15)14-6-5-12-9/h2-6H,7H2,1H3 |
| InChIKey | PQMXICKQJSNRQH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |