About 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine
5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine (PubChem CID 162174860) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine.
Molecular Properties
| Compound Name | 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine |
| PubChem CID | 162174860 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine |
| SMILES | CN1c2ncccc2Cc2nccnc21 |
| InChI | InChI=1S/C11H10N4/c1-15-10-8(3-2-4-13-10)7-9-11(15)14-6-5-12-9/h2-6H,7H2,1H3 |
| InChIKey | PQMXICKQJSNRQH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine?
The IUPAC name of 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine (CID 162174860) is 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine.
What is the SMILES notation for 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine?
The canonical SMILES for 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine is CN1c2ncccc2Cc2nccnc21.
What is the InChIKey of 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine?
The InChIKey is PQMXICKQJSNRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c1-15-10-8(3-2-4-13-10)7-9-11(15)14-6-5-12-9/h2-6H,7H2,1H3.
What are the key properties of 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine?
5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine has a molecular weight of 198.23 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-10H-pyrazino[2,3-b][1,8]naphthyridine is sourced from PubChem (CID 162174860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).