C17H20O6 — CID 162175228
(6Z,10S,12E)-10,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione;hydrate (PubChem CID 162175228) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (6Z,10S,12E)-10,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione;hydrate.
| Compound Name | (6Z,10S,12E)-10,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione;hydrate |
|---|---|
| PubChem CID | 162175228 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (6Z,10S,12E)-10,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione;hydrate |
| SMILES | O.O=C1/C=C\CCOC(=O)c2c(O)cccc2/C=C/C[C@H](O)C1 |
| InChI | InChI=1S/C17H18O5.H2O/c18-13-7-1-2-10-22-17(21)16-12(6-4-9-15(16)20)5-3-8-14(19)11-13;/h1,3-7,9,14,19-20H,2,8,10-11H2;1H2/b5-3+,7-1-;/t14-;/m0./s1 |
| InChIKey | PMKDDFONRVJMBJ-CFIWLRRWSA-N |
| XLogP | 1.41 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |