About methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate
methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate (PubChem CID 162175603) has the molecular formula C18H19ClN4O4
and a molecular weight of 390.83 g/mol. Its IUPAC name is methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate |
| PubChem CID | 162175603 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccccc2Cl)nc1C.COC(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C12H11ClN2O2.C6H8N2O2/c1-8-9(12(16)17-2)7-15(14-8)11-6-4-3-5-10(11)13;1-4-5(3-7-8-4)6(9)10-2/h3-7H,1-2H3;3H,1-2H3,(H,7,8) |
| InChIKey | ZOIVPYUDRLPBDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate?
The IUPAC name of methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate (CID 162175603) is methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate.
What is the SMILES notation for methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate?
The canonical SMILES for methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate is COC(=O)c1cn(-c2ccccc2Cl)nc1C.COC(=O)c1cn[nH]c1C.
What is the InChIKey of methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate?
The InChIKey is ZOIVPYUDRLPBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2.C6H8N2O2/c1-8-9(12(16)17-2)7-15(14-8)11-6-4-3-5-10(11)13;1-4-5(3-7-8-4)6(9)10-2/h3-7H,1-2H3;3H,1-2H3,(H,7,8).
What are the key properties of methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate?
methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate has a molecular weight of 390.83 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-chlorophenyl)-3-methylpyrazole-4-carboxylate;methyl 5-methyl-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 162175603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).