About naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride
naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride (PubChem CID 162176486) has the molecular formula C29H37ClN2O4S2
and a molecular weight of 577.21 g/mol. Its IUPAC name is naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride |
| PubChem CID | 162176486 |
| Molecular Formula | C29H37ClN2O4S2 |
| Molecular Weight | 577.21 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride |
| SMILES | CCCCCCCCS(=O)(=O)Cl.CS(=O)(=O)Nc1cccc2ccccc12.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C11H11NO2S.C10H9N.C8H17ClO2S/c1-15(13,14)12-11-8-4-6-9-5-2-3-7-10(9)11;11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-3-4-5-6-7-8-12(9,10)11/h2-8,12H,1H3;1-7H,11H2;2-8H2,1H3 |
| InChIKey | ZOLQXICPWMHWNJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.21 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride?
The IUPAC name of naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride (CID 162176486) is naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride.
What is the SMILES notation for naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride?
The canonical SMILES for naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride is CCCCCCCCS(=O)(=O)Cl.CS(=O)(=O)Nc1cccc2ccccc12.Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride?
The InChIKey is ZOLQXICPWMHWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S.C10H9N.C8H17ClO2S/c1-15(13,14)12-11-8-4-6-9-5-2-3-7-10(9)11;11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-3-4-5-6-7-8-12(9,10)11/h2-8,12H,1H3;1-7H,11H2;2-8H2,1H3.
What are the key properties of naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride?
naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride has a molecular weight of 577.21 g/mol, XLogP of 7.55, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-amine;N-naphthalen-1-ylmethanesulfonamide;octane-1-sulfonyl chloride is sourced from PubChem (CID 162176486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).